5,6-DIHYDRO-4H-CYCLOPENTA[D]THIAZOL-2-AMINE HYDROCHLORIDE - Names and Identifiers
Name | 2-Amino-5,6-dihydro-4H-cyclopentathiazole hydrochloride
|
Synonyms | 2-AMINO-5,6-DIHYDRO-4H-CYCLOPENTATHIAZOLE HCL 5,6-dihydro-4H-cyclopenta[d]thiazol-2-ylamine 5,6-Dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine 2-Amino-5,6-dihydro-4H-cyclopentathiazole hydrochloride 3,4,5,6-Tetrahydro-2H-cyclopenta(d)(1,3)thiazol-2-imine 3,4,5,6-Tetrahydro-2H-cyclopenta[d][1,3]thiazol-2-imine 2-AMINO-5,6-DIHYDRO-4H-CYCLOPENTATHIAZOLE HYDROCHLORIDE 5,6-DIHYDRO-4H-CYCLOPENTA[D]THIAZOL-2-AMINE HYDROCHLORIDE 5,6-DIHYDRO-4H-CYCLOPENTA[D][1,3]THIAZOL-2-AMINE HYDROCHLORIDE
|
CAS | 82514-58-7
|
InChI | InChI=1/C6H8N2S.ClH/c7-6-8-4-2-1-3-5(4)9-6;/h1-3H2,(H2,7,8);1H |
5,6-DIHYDRO-4H-CYCLOPENTA[D]THIAZOL-2-AMINE HYDROCHLORIDE - Physico-chemical Properties
Molecular Formula | C6H8N2S.ClH
|
Molar Mass | 176.67 |
Melting Point | 245-247 °C (decomp) |
Boling Point | 322.4°C at 760 mmHg |
Flash Point | 148.8°C |
Vapor Presure | 0.000203mmHg at 25°C |
Storage Condition | Sealed in dry,Room Temperature |
5,6-DIHYDRO-4H-CYCLOPENTA[D]THIAZOL-2-AMINE HYDROCHLORIDE - Introduction
2-Amino-5, hydrochloride is an organic compound with the chemical formula C5H10N2S · HCl. Its properties are as follows:
1. appearance: usually white crystalline powder or crystal.
2. Solubility: Soluble in water, but insoluble in most organic solvents.
3. melting point: about 210-215 degrees Celsius.
2-Amino-5, hydrochloride has certain application value in the field of medicine, mainly used in the synthesis of drugs or as intermediates. Its preparation involves synthesis through a series of organic synthesis steps starting from appropriate starting materials.
Regarding safety information, the following should be noted:
1. The substance has an irritating effect on the eyes, skin and respiratory tract, so appropriate protective measures should be taken when exposed, such as wearing chemical protective glasses, gloves and protective masks.
2. avoid inhalation of powder, if accidentally inhaled, should be immediately moved to a ventilated place fresh air.
3. If eaten by mistake, seek medical attention immediately and bring the packaging or label of the product.
4. in the process of handling and storage should pay attention to fire and electrostatic fire prevention measures, to ensure good ventilation.
In summary, 2-Amino-5, hydrochloride is an organic compound commonly used in the synthesis of drugs or as an intermediate. It is necessary to take appropriate protective measures during operation and pay attention to its safe use and storage.
Last Update:2024-04-09 20:49:11